ChemNet > CAS > 306937-22-4 ethyl 1-(3-aminobenzyl)piperidine-4-carboxylate
306937-22-4 ethyl 1-(3-aminobenzyl)piperidine-4-carboxylate
| Ürün Adı |
ethyl 1-(3-aminobenzyl)piperidine-4-carboxylate |
| Moleküler Formülü |
C15H22N2O2 |
| Molekül Ağırlığı |
262.3474 |
| InChI |
InChI=1/C15H22N2O2/c1-2-19-15(18)13-6-8-17(9-7-13)11-12-4-3-5-14(16)10-12/h3-5,10,13H,2,6-9,11,16H2,1H3 |
| CAS kayıt numarası |
306937-22-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.129g/cm3 |
| Ergime noktası |
49℃ |
| Kaynama noktası |
384.1°C at 760 mmHg |
| Kırılma indisi |
1.564 |
| Alevlenme noktası |
186.1°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
